C18H24O6S — CID 59776783
(16S,17S)-13-methyl-3-(trioxidanylsulfanyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-16,17-diol (PubChem CID 59776783) has the molecular formula C18H24O6S and a molecular weight of 368.45 g/mol. Its IUPAC name is (16S,17S)-13-methyl-3-(trioxidanylsulfanyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-16,17-diol.
| Compound Name | (16S,17S)-13-methyl-3-(trioxidanylsulfanyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-16,17-diol |
|---|---|
| PubChem CID | 59776783 |
| Molecular Formula | C18H24O6S |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (16S,17S)-13-methyl-3-(trioxidanylsulfanyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-16,17-diol |
| SMILES | CC12CCC3c4ccc(OSOOO)cc4CCC3C1C[C@H](O)[C@H]2O |
| InChI | InChI=1S/C18H24O6S/c1-18-7-6-13-12-5-3-11(22-25-24-23-21)8-10(12)2-4-14(13)15(18)9-16(19)17(18)20/h3,5,8,13-17,19-21H,2,4,6-7,9H2,1H3/t13?,14?,15?,16-,17+,18?/m0/s1 |
| InChIKey | TXDBJCAULROHDU-PVGHXWSTSA-N |
| XLogP | 3.24 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|