C18H23FO2S — CID 138663973
(17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl)oxy thiohypofluorite (PubChem CID 138663973) has the molecular formula C18H23FO2S and a molecular weight of 322.44 g/mol. Its IUPAC name is (17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl)oxy thiohypofluorite.
| Compound Name | (17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl)oxy thiohypofluorite |
|---|---|
| PubChem CID | 138663973 |
| Molecular Formula | C18H23FO2S |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl)oxy thiohypofluorite |
| SMILES | CC12CCC3c4ccc(OSF)cc4CCC3C1CCC2O |
| InChI | InChI=1S/C18H23FO2S/c1-18-9-8-14-13-5-3-12(21-22-19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,20H,2,4,6-9H2,1H3 |
| InChIKey | PWJQNIWWPCGMBM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|