C18H23NaO5S — CID 59776784
sodium (17S)-13-methyl-3-oxidoperoxysulfanyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 59776784) has the molecular formula C18H23NaO5S and a molecular weight of 374.43 g/mol. Its IUPAC name is sodium (17S)-13-methyl-3-oxidoperoxysulfanyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | sodium (17S)-13-methyl-3-oxidoperoxysulfanyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 59776784 |
| Molecular Formula | C18H23NaO5S |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | sodium (17S)-13-methyl-3-oxidoperoxysulfanyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | CC12CCC3c4ccc(OSOO[O-])cc4CCC3C1CC[C@@H]2O.[Na+] |
| InChI | InChI=1S/C18H24O5S.Na/c1-18-9-8-14-13-5-3-12(21-24-23-22-20)10-11(13)2-4-15(14)16(18)6-7-17(18)19;/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3;/q;+1/p-1/t14?,15?,16?,17-,18?;/m0./s1 |
| InChIKey | RWRIVQWMIPNBDQ-HQQIMNJBSA-M |
| XLogP | 0.07 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|