C23H34O2 — CID 121384840
(8R,9S,13S,14S,16S,17S)-13,16-dimethyl-3-[(2-methylpropan-2-yl)oxy]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 121384840) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is (8R,9S,13S,14S,16S,17S)-13,16-dimethyl-3-[(2-methylpropan-2-yl)oxy]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9S,13S,14S,16S,17S)-13,16-dimethyl-3-[(2-methylpropan-2-yl)oxy]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 121384840 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | (8R,9S,13S,14S,16S,17S)-13,16-dimethyl-3-[(2-methylpropan-2-yl)oxy]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@H]1C[C@H]2[C@@H]3CCc4cc(OC(C)(C)C)ccc4[C@H]3CC[C@]2(C)[C@H]1O |
| InChI | InChI=1S/C23H34O2/c1-14-12-20-19-8-6-15-13-16(25-22(2,3)4)7-9-17(15)18(19)10-11-23(20,5)21(14)24/h7,9,13-14,18-21,24H,6,8,10-12H2,1-5H3/t14-,18+,19+,20-,21-,23-/m0/s1 |
| InChIKey | ACXLDAISNCRBCE-DKRUVMIZSA-N |
| XLogP | 5.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |