C23H33NO4S — CID 20589389
[(13S,14R,17S)-17-hydroxy-13-methyl-15-methylidene-7,8,9,11,12,14,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] N,N-diethylsulfamate (PubChem CID 20589389) has the molecular formula C23H33NO4S and a molecular weight of 419.59 g/mol. Its IUPAC name is [(13S,14R,17S)-17-hydroxy-13-methyl-15-methylidene-7,8,9,11,12,14,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] N,N-diethylsulfamate.
| Compound Name | [(13S,14R,17S)-17-hydroxy-13-methyl-15-methylidene-7,8,9,11,12,14,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] N,N-diethylsulfamate |
|---|---|
| PubChem CID | 20589389 |
| Molecular Formula | C23H33NO4S |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | [(13S,14R,17S)-17-hydroxy-13-methyl-15-methylidene-7,8,9,11,12,14,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] N,N-diethylsulfamate |
| SMILES | C=C1C[C@H](O)[C@@]2(C)CCC3c4ccc(OS(=O)(=O)N(CC)CC)cc4CCC3[C@H]12 |
| InChI | InChI=1S/C23H33NO4S/c1-5-24(6-2)29(26,27)28-17-8-10-18-16(14-17)7-9-20-19(18)11-12-23(4)21(25)13-15(3)22(20)23/h8,10,14,19-22,25H,3,5-7,9,11-13H2,1-2,4H3/t19?,20?,21-,22-,23+/m0/s1 |
| InChIKey | XRHQNAURDKLZPJ-KUADZGEYSA-N |
| XLogP | 4.04 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|