C21H27NO4S — CID 57114822
[(13R)-13-methyl-15-methylidene-7,8,9,11,12,14,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] N-acetylsulfamate (PubChem CID 57114822) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is [(13R)-13-methyl-15-methylidene-7,8,9,11,12,14,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] N-acetylsulfamate.
| Compound Name | [(13R)-13-methyl-15-methylidene-7,8,9,11,12,14,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] N-acetylsulfamate |
|---|---|
| PubChem CID | 57114822 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | [(13R)-13-methyl-15-methylidene-7,8,9,11,12,14,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] N-acetylsulfamate |
| SMILES | C=C1CC[C@@]2(C)CCC3c4ccc(OS(=O)(=O)NC(C)=O)cc4CCC3C12 |
| InChI | InChI=1S/C21H27NO4S/c1-13-8-10-21(3)11-9-18-17-7-5-16(26-27(24,25)22-14(2)23)12-15(17)4-6-19(18)20(13)21/h5,7,12,18-20H,1,4,6,8-11H2,2-3H3,(H,22,23)/t18?,19?,20?,21-/m0/s1 |
| InChIKey | BUUAOXMNRKIGDW-FNNAPWSISA-N |
| XLogP | 3.86 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|