C21H28O2 — CID 101249766
1-[(1S,2R,4aS,10aR)-7-methoxy-2-methyl-1-prop-2-enyl-3,4,4a,9,10,10a-hexahydro-1H-phenanthren-2-yl]ethanone (PubChem CID 101249766) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is 1-[(1S,2R,4aS,10aR)-7-methoxy-2-methyl-1-prop-2-enyl-3,4,4a,9,10,10a-hexahydro-1H-phenanthren-2-yl]ethanone.
| Compound Name | 1-[(1S,2R,4aS,10aR)-7-methoxy-2-methyl-1-prop-2-enyl-3,4,4a,9,10,10a-hexahydro-1H-phenanthren-2-yl]ethanone |
|---|---|
| PubChem CID | 101249766 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 1-[(1S,2R,4aS,10aR)-7-methoxy-2-methyl-1-prop-2-enyl-3,4,4a,9,10,10a-hexahydro-1H-phenanthren-2-yl]ethanone |
| SMILES | C=CC[C@H]1[C@@H]2CCc3cc(OC)ccc3[C@H]2CC[C@@]1(C)C(C)=O |
| InChI | InChI=1S/C21H28O2/c1-5-6-20-19-9-7-15-13-16(23-4)8-10-17(15)18(19)11-12-21(20,3)14(2)22/h5,8,10,13,18-20H,1,6-7,9,11-12H2,2-4H3/t18-,19-,20+,21+/m1/s1 |
| InChIKey | XTTAPINFCXOJST-CGXNFDGLSA-N |
| XLogP | 4.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|