C26H38O7 — CID 53356275
(2R,3R,4S,5R,6R)-2-[[(1S,2S,4aS,10aR)-7-methoxy-2-methyl-1-prop-2-enyl-3,4,4a,9,10,10a-hexahydro-1H-phenanthren-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 53356275) has the molecular formula C26H38O7 and a molecular weight of 462.58 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-[[(1S,2S,4aS,10aR)-7-methoxy-2-methyl-1-prop-2-enyl-3,4,4a,9,10,10a-hexahydro-1H-phenanthren-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-2-[[(1S,2S,4aS,10aR)-7-methoxy-2-methyl-1-prop-2-enyl-3,4,4a,9,10,10a-hexahydro-1H-phenanthren-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 53356275 |
| Molecular Formula | C26H38O7 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-[[(1S,2S,4aS,10aR)-7-methoxy-2-methyl-1-prop-2-enyl-3,4,4a,9,10,10a-hexahydro-1H-phenanthren-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C=CC[C@H]1[C@@H]2CCc3cc(OC)ccc3[C@H]2CC[C@]1(C)CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C26H38O7/c1-4-5-20-19-8-6-15-12-16(31-3)7-9-17(15)18(19)10-11-26(20,2)14-32-25-24(30)23(29)22(28)21(13-27)33-25/h4,7,9,12,18-25,27-30H,1,5-6,8,10-11,13-14H2,2-3H3/t18-,19-,20+,21-,22+,23+,24-,25-,26-/m1/s1 |
| InChIKey | GOZNCHYDRHFZRF-RAIBZATRSA-N |
| XLogP | 2.15 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|