C27H38O7 — CID 53354879
(2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-[[(1R,2S,7R,8S,11S)-15-methoxy-8-methyl-7-tetracyclo[9.8.0.02,8.012,17]nonadeca-4,12(17),13,15-tetraenyl]oxy]oxane-3,4,5-triol (PubChem CID 53354879) has the molecular formula C27H38O7 and a molecular weight of 474.59 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-[[(1R,2S,7R,8S,11S)-15-methoxy-8-methyl-7-tetracyclo[9.8.0.02,8.012,17]nonadeca-4,12(17),13,15-tetraenyl]oxy]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-[[(1R,2S,7R,8S,11S)-15-methoxy-8-methyl-7-tetracyclo[9.8.0.02,8.012,17]nonadeca-4,12(17),13,15-tetraenyl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 53354879 |
| Molecular Formula | C27H38O7 |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-[[(1R,2S,7R,8S,11S)-15-methoxy-8-methyl-7-tetracyclo[9.8.0.02,8.012,17]nonadeca-4,12(17),13,15-tetraenyl]oxy]oxane-3,4,5-triol |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@H](O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)CC=CC[C@@H]12 |
| InChI | InChI=1S/C27H38O7/c1-27-12-11-18-17-10-8-16(32-2)13-15(17)7-9-19(18)20(27)5-3-4-6-22(27)34-26-25(31)24(30)23(29)21(14-28)33-26/h3-4,8,10,13,18-26,28-31H,5-7,9,11-12,14H2,1-2H3/t18-,19-,20+,21-,22-,23+,24+,25-,26+,27+/m1/s1 |
| InChIKey | JMTGDFULTKSKQT-UBILIORQSA-N |
| XLogP | 2.29 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|