C23H29BrO4 — CID 15677081
[(8R,9S,13S,14S,16R)-16-(bromomethyl)-3-methoxy-13-methyl-17-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-16-yl]methyl acetate (PubChem CID 15677081) has the molecular formula C23H29BrO4 and a molecular weight of 449.39 g/mol. Its IUPAC name is [(8R,9S,13S,14S,16R)-16-(bromomethyl)-3-methoxy-13-methyl-17-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-16-yl]methyl acetate.
| Compound Name | [(8R,9S,13S,14S,16R)-16-(bromomethyl)-3-methoxy-13-methyl-17-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-16-yl]methyl acetate |
|---|---|
| PubChem CID | 15677081 |
| Molecular Formula | C23H29BrO4 |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | [(8R,9S,13S,14S,16R)-16-(bromomethyl)-3-methoxy-13-methyl-17-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-16-yl]methyl acetate |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)[C@](CBr)(COC(C)=O)C[C@@H]12 |
| InChI | InChI=1S/C23H29BrO4/c1-14(25)28-13-23(12-24)11-20-19-6-4-15-10-16(27-3)5-7-17(15)18(19)8-9-22(20,2)21(23)26/h5,7,10,18-20H,4,6,8-9,11-13H2,1-3H3/t18-,19-,20+,22+,23-/m1/s1 |
| InChIKey | YWZRJKRAMOSFGN-BQLVWXCYSA-N |
| XLogP | 4.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|