C21H28O5 — CID 7279709
methyl (1R,2S,4aS,10aS)-7-methoxy-1-(2-methoxy-2-oxoethyl)-2-methyl-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene-2-carboxylate (PubChem CID 7279709) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is methyl (1R,2S,4aS,10aS)-7-methoxy-1-(2-methoxy-2-oxoethyl)-2-methyl-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene-2-carboxylate.
| Compound Name | methyl (1R,2S,4aS,10aS)-7-methoxy-1-(2-methoxy-2-oxoethyl)-2-methyl-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene-2-carboxylate |
|---|---|
| PubChem CID | 7279709 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | methyl (1R,2S,4aS,10aS)-7-methoxy-1-(2-methoxy-2-oxoethyl)-2-methyl-3,4,4a,9,10,10a-hexahydro-1H-phenanthrene-2-carboxylate |
| SMILES | COC(=O)C[C@@H]1[C@H]2CCc3cc(OC)ccc3[C@H]2CC[C@]1(C)C(=O)OC |
| InChI | InChI=1S/C21H28O5/c1-21(20(23)26-4)10-9-16-15-8-6-14(24-2)11-13(15)5-7-17(16)18(21)12-19(22)25-3/h6,8,11,16-18H,5,7,9-10,12H2,1-4H3/t16-,17+,18-,21+/m1/s1 |
| InChIKey | CJQXBBCJIYBIMS-IIMDRIAPSA-N |
| XLogP | 3.49 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |