C20H25NO4S — CID 70002572
[(8R,9S,13S,14R)-13-methyl-15-methylidene-17-oxo-7,8,9,11,12,14-hexahydro-6H-cyclopenta[a]phenanthren-3-yl] N-methylsulfamate (PubChem CID 70002572) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is [(8R,9S,13S,14R)-13-methyl-15-methylidene-17-oxo-7,8,9,11,12,14-hexahydro-6H-cyclopenta[a]phenanthren-3-yl] N-methylsulfamate.
| Compound Name | [(8R,9S,13S,14R)-13-methyl-15-methylidene-17-oxo-7,8,9,11,12,14-hexahydro-6H-cyclopenta[a]phenanthren-3-yl] N-methylsulfamate |
|---|---|
| PubChem CID | 70002572 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | [(8R,9S,13S,14R)-13-methyl-15-methylidene-17-oxo-7,8,9,11,12,14-hexahydro-6H-cyclopenta[a]phenanthren-3-yl] N-methylsulfamate |
| SMILES | C=C1CC(=O)[C@@]2(C)CC[C@@H]3c4ccc(OS(=O)(=O)NC)cc4CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C20H25NO4S/c1-12-10-18(22)20(2)9-8-16-15-7-5-14(25-26(23,24)21-3)11-13(15)4-6-17(16)19(12)20/h5,7,11,16-17,19,21H,1,4,6,8-10H2,2-3H3/t16-,17-,19+,20-/m1/s1 |
| InChIKey | UFZHSCZBMYHXPL-IZBJGVDFSA-N |
| XLogP | 3.12 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|