C20H23Cl3O5S — CID 134877905
[(13S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 2,2,2-trichloroethyl sulfate (PubChem CID 134877905) has the molecular formula C20H23Cl3O5S and a molecular weight of 481.83 g/mol. Its IUPAC name is [(13S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 2,2,2-trichloroethyl sulfate.
| Compound Name | [(13S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 2,2,2-trichloroethyl sulfate |
|---|---|
| PubChem CID | 134877905 |
| Molecular Formula | C20H23Cl3O5S |
| Molecular Weight | 481.83 g/mol |
| Exact Mass | 480.03 |
| IUPAC Name | [(13S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 2,2,2-trichloroethyl sulfate |
| SMILES | C[C@]12CCC3c4ccc(OS(=O)(=O)OCC(Cl)(Cl)Cl)cc4CCC3C1CCC2=O |
| InChI | InChI=1S/C20H23Cl3O5S/c1-19-9-8-15-14-5-3-13(28-29(25,26)27-11-20(21,22)23)10-12(14)2-4-16(15)17(19)6-7-18(19)24/h3,5,10,15-17H,2,4,6-9,11H2,1H3/t15?,16?,17?,19-/m0/s1 |
| InChIKey | VBBDUIPMVKCPKT-QMUDONBSSA-N |
| XLogP | 5.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.83 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|