C19H20F4O4S — CID 10093577
[(8R,9S,13S,14S,16S)-16-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate (PubChem CID 10093577) has the molecular formula C19H20F4O4S and a molecular weight of 420.42 g/mol. Its IUPAC name is [(8R,9S,13S,14S,16S)-16-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate.
| Compound Name | [(8R,9S,13S,14S,16S)-16-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10093577 |
| Molecular Formula | C19H20F4O4S |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | [(8R,9S,13S,14S,16S)-16-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OS(=O)(=O)C(F)(F)F)cc4CC[C@H]3[C@@H]1C[C@H](F)C2=O |
| InChI | InChI=1S/C19H20F4O4S/c1-18-7-6-13-12-5-3-11(27-28(25,26)19(21,22)23)8-10(12)2-4-14(13)15(18)9-16(20)17(18)24/h3,5,8,13-16H,2,4,6-7,9H2,1H3/t13-,14-,15+,16+,18+/m1/s1 |
| InChIKey | MZLUIOPUJTUEGV-LFRCEIEQSA-N |
| XLogP | 4.29 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|