C22H20F6O5 — CID 22296069
[(8R,9S,13S,14S)-13-methyl-17-oxo-3-(2,2,2-trifluoroacetyl)oxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl] 2,2,2-trifluoroacetate (PubChem CID 22296069) has the molecular formula C22H20F6O5 and a molecular weight of 478.39 g/mol. Its IUPAC name is [(8R,9S,13S,14S)-13-methyl-17-oxo-3-(2,2,2-trifluoroacetyl)oxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(8R,9S,13S,14S)-13-methyl-17-oxo-3-(2,2,2-trifluoroacetyl)oxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 22296069 |
| Molecular Formula | C22H20F6O5 |
| Molecular Weight | 478.39 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | [(8R,9S,13S,14S)-13-methyl-17-oxo-3-(2,2,2-trifluoroacetyl)oxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl] 2,2,2-trifluoroacetate |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OC(=O)C(F)(F)F)cc4CC[C@H]3[C@@H]1CC(OC(=O)C(F)(F)F)C2=O |
| InChI | InChI=1S/C22H20F6O5/c1-20-7-6-13-12-5-3-11(32-18(30)21(23,24)25)8-10(12)2-4-14(13)15(20)9-16(17(20)29)33-19(31)22(26,27)28/h3,5,8,13-16H,2,4,6-7,9H2,1H3/t13-,14-,15+,16?,20+/m1/s1 |
| InChIKey | UMQDMZKPNXRPDL-PARUGHGHSA-N |
| XLogP | 4.66 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|