C23H28O6 — CID 22296491
[(8R,9S,13S,14S)-3-acetyloxy-2-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl] acetate (PubChem CID 22296491) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is [(8R,9S,13S,14S)-3-acetyloxy-2-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl] acetate.
| Compound Name | [(8R,9S,13S,14S)-3-acetyloxy-2-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl] acetate |
|---|---|
| PubChem CID | 22296491 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | [(8R,9S,13S,14S)-3-acetyloxy-2-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl] acetate |
| SMILES | COc1cc2c(cc1OC(C)=O)CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)C(OC(C)=O)C[C@@H]12 |
| InChI | InChI=1S/C23H28O6/c1-12(24)28-20-9-14-5-6-16-15(17(14)10-19(20)27-4)7-8-23(3)18(16)11-21(22(23)26)29-13(2)25/h9-10,15-16,18,21H,5-8,11H2,1-4H3/t15-,16+,18-,21?,23-/m0/s1 |
| InChIKey | TXSQFLFBOJONHM-HORBABPOSA-N |
| XLogP | 3.59 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|