C21H25ClO4 — CID 70614380
[(8R,9S,13S,14S,16R)-16-chloro-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl] acetate (PubChem CID 70614380) has the molecular formula C21H25ClO4 and a molecular weight of 376.88 g/mol. Its IUPAC name is [(8R,9S,13S,14S,16R)-16-chloro-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl] acetate.
| Compound Name | [(8R,9S,13S,14S,16R)-16-chloro-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl] acetate |
|---|---|
| PubChem CID | 70614380 |
| Molecular Formula | C21H25ClO4 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | [(8R,9S,13S,14S,16R)-16-chloro-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl] acetate |
| SMILES | COc1cc2c(c(OC(C)=O)c1)[C@H]1CC[C@]3(C)C(=O)[C@H](Cl)C[C@H]3[C@@H]1CC2 |
| InChI | InChI=1S/C21H25ClO4/c1-11(23)26-18-9-13(25-3)8-12-4-5-14-15(19(12)18)6-7-21(2)16(14)10-17(22)20(21)24/h8-9,14-17H,4-7,10H2,1-3H3/t14-,15+,16+,17-,21+/m1/s1 |
| InChIKey | IBEBCEUUCXCKMP-FMWYQGOYSA-N |
| XLogP | 4.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|