C22H30O3 — CID 22803858
(8R,9S,13S,14S)-1,3-diethoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 22803858) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is (8R,9S,13S,14S)-1,3-diethoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-1,3-diethoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 22803858 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (8R,9S,13S,14S)-1,3-diethoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | CCOc1cc2c(c(OCC)c1)[C@H]1CC[C@]3(C)C(=O)CC[C@H]3[C@@H]1CC2 |
| InChI | InChI=1S/C22H30O3/c1-4-24-15-12-14-6-7-16-17(21(14)19(13-15)25-5-2)10-11-22(3)18(16)8-9-20(22)23/h12-13,16-18H,4-11H2,1-3H3/t16-,17+,18+,22+/m1/s1 |
| InChIKey | KMNFUSBZOSCZDY-MSQSPTIYSA-N |
| XLogP | 4.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |