C24H35O2Si — CID 67111520
CID 67111520 (PubChem CID 67111520) has the molecular formula C24H35O2Si and a molecular weight of 383.63 g/mol.
| Compound Name | CID 67111520 |
|---|---|
| PubChem CID | 67111520 |
| Molecular Formula | C24H35O2Si |
| Molecular Weight | 383.63 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | — |
| SMILES | C[Si](C)Oc1cc(C(C)(C)C)cc2c1[C@H]1CC[C@]3(C)C(=O)CC[C@H]3[C@@H]1CC2 |
| InChI | InChI=1S/C24H35O2Si/c1-23(2,3)16-13-15-7-8-17-18(22(15)20(14-16)26-27(5)6)11-12-24(4)19(17)9-10-21(24)25/h13-14,17-19H,7-12H2,1-6H3/t17-,18+,19+,24+/m1/s1 |
| InChIKey | YUGDVQNFJLDOIY-RAZUEPIFSA-N |
| XLogP | 6.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.63 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|