C24H37NO2Si — CID 10250343
(8R,9S,13S,14S)-2-amino-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 10250343) has the molecular formula C24H37NO2Si and a molecular weight of 399.65 g/mol. Its IUPAC name is (8R,9S,13S,14S)-2-amino-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-2-amino-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 10250343 |
| Molecular Formula | C24H37NO2Si |
| Molecular Weight | 399.65 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | (8R,9S,13S,14S)-2-amino-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cc2c(cc1N)[C@H]1CC[C@]3(C)C(=O)CC[C@H]3[C@@H]1CC2 |
| InChI | InChI=1S/C24H37NO2Si/c1-23(2,3)28(5,6)27-21-13-15-7-8-17-16(18(15)14-20(21)25)11-12-24(4)19(17)9-10-22(24)26/h13-14,16-17,19H,7-12,25H2,1-6H3/t16-,17+,19-,24-/m0/s1 |
| InChIKey | YZRIWUHJNFDMSO-MIVVTYSHSA-N |
| XLogP | 6.08 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.65 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|