C26H37NO3Si — CID 67348930
3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-16-carbonitrile (PubChem CID 67348930) has the molecular formula C26H37NO3Si and a molecular weight of 439.67 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-16-carbonitrile.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-16-carbonitrile |
|---|---|
| PubChem CID | 67348930 |
| Molecular Formula | C26H37NO3Si |
| Molecular Weight | 439.67 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-16-carbonitrile |
| SMILES | COc1cc2c(cc1O[Si](C)(C)C(C)(C)C)CCC1C2CCC2(C)C(=O)C(C#N)CC12 |
| InChI | InChI=1S/C26H37NO3Si/c1-25(2,3)31(6,7)30-23-13-16-8-9-19-18(20(16)14-22(23)29-5)10-11-26(4)21(19)12-17(15-27)24(26)28/h13-14,17-19,21H,8-12H2,1-7H3 |
| InChIKey | SBELTOWZXKKWBP-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.67 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|