C31H52N2O3Si — CID 58636505
(13S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-13-methyl-N-(2-morpholin-4-ylethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-amine (PubChem CID 58636505) has the molecular formula C31H52N2O3Si and a molecular weight of 528.85 g/mol. Its IUPAC name is (13S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-13-methyl-N-(2-morpholin-4-ylethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-amine.
| Compound Name | (13S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-13-methyl-N-(2-morpholin-4-ylethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-amine |
|---|---|
| PubChem CID | 58636505 |
| Molecular Formula | C31H52N2O3Si |
| Molecular Weight | 528.85 g/mol |
| Exact Mass | 528.37 |
| IUPAC Name | (13S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-13-methyl-N-(2-morpholin-4-ylethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-amine |
| SMILES | COc1cc2c(cc1O[Si](C)(C)C(C)(C)C)CCC1C2CC[C@@]2(C)C1CC[C@@H]2NCCN1CCOCC1 |
| InChI | InChI=1S/C31H52N2O3Si/c1-30(2,3)37(6,7)36-28-20-22-8-9-24-23(25(22)21-27(28)34-5)12-13-31(4)26(24)10-11-29(31)32-14-15-33-16-18-35-19-17-33/h20-21,23-24,26,29,32H,8-19H2,1-7H3/t23?,24?,26?,29-,31-/m0/s1 |
| InChIKey | FTSHSTMACRDIED-OPLSZASJSA-N |
| XLogP | 6.23 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.85 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|