C24H36O5 — CID 142945037
acetic acid;ethane;3-hydroxy-2-methoxy-13,16-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 142945037) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is acetic acid;ethane;3-hydroxy-2-methoxy-13,16-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | acetic acid;ethane;3-hydroxy-2-methoxy-13,16-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 142945037 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | acetic acid;ethane;3-hydroxy-2-methoxy-13,16-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | CC.CC(=O)O.COc1cc2c(cc1O)CCC1C2CCC2(C)C(=O)C(C)CC12 |
| InChI | InChI=1S/C20H26O3.C2H4O2.C2H6/c1-11-8-16-14-5-4-12-9-17(21)18(23-3)10-15(12)13(14)6-7-20(16,2)19(11)22;1-2(3)4;1-2/h9-11,13-14,16,21H,4-8H2,1-3H3;1H3,(H,3,4);1-2H3 |
| InChIKey | CMAAHGFWRYPERV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |