C18H22FNO4S — CID 59985753
(13S)-3-aminoperoxysulfanyloxy-2-fluoro-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 59985753) has the molecular formula C18H22FNO4S and a molecular weight of 367.44 g/mol. Its IUPAC name is (13S)-3-aminoperoxysulfanyloxy-2-fluoro-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (13S)-3-aminoperoxysulfanyloxy-2-fluoro-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 59985753 |
| Molecular Formula | C18H22FNO4S |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | (13S)-3-aminoperoxysulfanyloxy-2-fluoro-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CCC3c4cc(F)c(OSOON)cc4CCC3C1CCC2=O |
| InChI | InChI=1S/C18H22FNO4S/c1-18-7-6-11-12(14(18)4-5-17(18)21)3-2-10-8-16(22-25-24-23-20)15(19)9-13(10)11/h8-9,11-12,14H,2-7,20H2,1H3/t11?,12?,14?,18-/m0/s1 |
| InChIKey | CYLDESOMRWPXQP-PEDDLLMLSA-N |
| XLogP | 4.01 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|