C22H32FNO3S — CID 58972051
O-[[(13R,17R)-2-ethyl-17-(2-fluoroethyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxysulfanyloxy]hydroxylamine (PubChem CID 58972051) has the molecular formula C22H32FNO3S and a molecular weight of 409.57 g/mol. Its IUPAC name is O-[[(13R,17R)-2-ethyl-17-(2-fluoroethyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxysulfanyloxy]hydroxylamine.
| Compound Name | O-[[(13R,17R)-2-ethyl-17-(2-fluoroethyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxysulfanyloxy]hydroxylamine |
|---|---|
| PubChem CID | 58972051 |
| Molecular Formula | C22H32FNO3S |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | O-[[(13R,17R)-2-ethyl-17-(2-fluoroethyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxysulfanyloxy]hydroxylamine |
| SMILES | CCc1cc2c(cc1OSOON)CCC1C2CC[C@@]2(C)C1CC[C@@H]2CCF |
| InChI | InChI=1S/C22H32FNO3S/c1-3-14-12-19-15(13-21(14)25-28-27-26-24)4-6-18-17(19)8-10-22(2)16(9-11-23)5-7-20(18)22/h12-13,16-18,20H,3-11,24H2,1-2H3/t16-,17?,18?,20?,22-/m1/s1 |
| InChIKey | YQZKUBDGLOGOFK-CTYSQQGOSA-N |
| XLogP | 5.84 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|