C30H38N4O — CID 25171552
5-[[(8S,9S,13R,14S,17R)-2-ethyl-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]methyl]-2-methyltetrazole (PubChem CID 25171552) has the molecular formula C30H38N4O and a molecular weight of 470.66 g/mol. Its IUPAC name is 5-[[(8S,9S,13R,14S,17R)-2-ethyl-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]methyl]-2-methyltetrazole.
| Compound Name | 5-[[(8S,9S,13R,14S,17R)-2-ethyl-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]methyl]-2-methyltetrazole |
|---|---|
| PubChem CID | 25171552 |
| Molecular Formula | C30H38N4O |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | 5-[[(8S,9S,13R,14S,17R)-2-ethyl-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]methyl]-2-methyltetrazole |
| SMILES | CCc1cc2c(cc1OCc1ccccc1)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](Cc3nnn(C)n3)CC[C@@H]12 |
| InChI | InChI=1S/C30H38N4O/c1-4-21-16-26-22(17-28(21)35-19-20-8-6-5-7-9-20)10-12-25-24(26)14-15-30(2)23(11-13-27(25)30)18-29-31-33-34(3)32-29/h5-9,16-17,23-25,27H,4,10-15,18-19H2,1-3H3/t23-,24+,25-,27+,30-/m1/s1 |
| InChIKey | BRWVETHRJYWTRV-XUCYNPHFSA-N |
| XLogP | 6.07 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |