C29H36O — CID 53363546
(8S,9S,13S,14S,17E)-2-ethyl-17-ethylidene-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene (PubChem CID 53363546) has the molecular formula C29H36O and a molecular weight of 400.61 g/mol. Its IUPAC name is (8S,9S,13S,14S,17E)-2-ethyl-17-ethylidene-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene.
| Compound Name | (8S,9S,13S,14S,17E)-2-ethyl-17-ethylidene-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 53363546 |
| Molecular Formula | C29H36O |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | (8S,9S,13S,14S,17E)-2-ethyl-17-ethylidene-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene |
| SMILES | C/C=C1\CC[C@H]2[C@@H]3CCc4cc(OCc5ccccc5)c(CC)cc4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H36O/c1-4-21-17-26-22(18-28(21)30-19-20-9-7-6-8-10-20)11-13-25-24(26)15-16-29(3)23(5-2)12-14-27(25)29/h5-10,17-18,24-25,27H,4,11-16,19H2,1-3H3/b23-5+/t24-,25+,27-,29+/m0/s1 |
| InChIKey | BLDJWVXWNYFNLR-SAUNMVHNSA-N |
| XLogP | 7.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|