C30H37NO2 — CID 66959147
3-[(8R,9S,13S,14S,17R)-2-ethyl-17-hydroxy-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]propanenitrile (PubChem CID 66959147) has the molecular formula C30H37NO2 and a molecular weight of 443.63 g/mol. Its IUPAC name is 3-[(8R,9S,13S,14S,17R)-2-ethyl-17-hydroxy-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]propanenitrile.
| Compound Name | 3-[(8R,9S,13S,14S,17R)-2-ethyl-17-hydroxy-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]propanenitrile |
|---|---|
| PubChem CID | 66959147 |
| Molecular Formula | C30H37NO2 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | 3-[(8R,9S,13S,14S,17R)-2-ethyl-17-hydroxy-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]propanenitrile |
| SMILES | CCc1cc2c(cc1OCc1ccccc1)CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(O)CCC#N |
| InChI | InChI=1S/C30H37NO2/c1-3-22-18-26-23(19-28(22)33-20-21-8-5-4-6-9-21)10-11-25-24(26)12-15-29(2)27(25)13-16-30(29,32)14-7-17-31/h4-6,8-9,18-19,24-25,27,32H,3,7,10-16,20H2,1-2H3/t24-,25+,27-,29-,30-/m0/s1 |
| InChIKey | ZCLZYOLHPRWIQW-GKUJDVGKSA-N |
| XLogP | 6.72 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |