C27H32O3 — CID 10787419
(8R,9S,13S,14S)-2-ethoxy-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 10787419) has the molecular formula C27H32O3 and a molecular weight of 404.55 g/mol. Its IUPAC name is (8R,9S,13S,14S)-2-ethoxy-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-2-ethoxy-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 10787419 |
| Molecular Formula | C27H32O3 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | (8R,9S,13S,14S)-2-ethoxy-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | CCOc1cc2c(cc1OCc1ccccc1)CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C27H32O3/c1-3-29-25-16-22-19(15-24(25)30-17-18-7-5-4-6-8-18)9-10-21-20(22)13-14-27(2)23(21)11-12-26(27)28/h4-8,15-16,20-21,23H,3,9-14,17H2,1-2H3/t20-,21+,23-,27-/m0/s1 |
| InChIKey | NULLVRPYBQTEPV-VBXWPYOKSA-N |
| XLogP | 6.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |