C26H28O3 — CID 571429
(2,13-dimethyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) benzoate (PubChem CID 571429) has the molecular formula C26H28O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is (2,13-dimethyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) benzoate.
| Compound Name | (2,13-dimethyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) benzoate |
|---|---|
| PubChem CID | 571429 |
| Molecular Formula | C26H28O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | (2,13-dimethyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) benzoate |
| SMILES | Cc1cc2c(cc1OC(=O)c1ccccc1)CCC1C2CCC2(C)C(=O)CCC12 |
| InChI | InChI=1S/C26H28O3/c1-16-14-21-18(15-23(16)29-25(28)17-6-4-3-5-7-17)8-9-20-19(21)12-13-26(2)22(20)10-11-24(26)27/h3-7,14-15,19-20,22H,8-13H2,1-2H3 |
| InChIKey | WHKKBBJESWAKNJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|