C24H25NO3 — CID 102152378
[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] pyridine-2-carboxylate (PubChem CID 102152378) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] pyridine-2-carboxylate.
| Compound Name | [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 102152378 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] pyridine-2-carboxylate |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OC(=O)c5ccccn5)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C24H25NO3/c1-24-12-11-18-17-8-6-16(28-23(27)21-4-2-3-13-25-21)14-15(17)5-7-19(18)20(24)9-10-22(24)26/h2-4,6,8,13-14,18-20H,5,7,9-12H2,1H3/t18-,19-,20+,24+/m1/s1 |
| InChIKey | CGGUITPXNUCPJO-FDGPYGQJSA-N |
| XLogP | 4.73 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|