C27H32OS — CID 46197573
(8R,9S,13S,14S)-2-ethyl-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-thione (PubChem CID 46197573) has the molecular formula C27H32OS and a molecular weight of 404.62 g/mol. Its IUPAC name is (8R,9S,13S,14S)-2-ethyl-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-thione.
| Compound Name | (8R,9S,13S,14S)-2-ethyl-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-thione |
|---|---|
| PubChem CID | 46197573 |
| Molecular Formula | C27H32OS |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (8R,9S,13S,14S)-2-ethyl-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-thione |
| SMILES | CCc1cc2c(cc1OCc1ccccc1)CC[C@@H]1[C@@H]2CC[C@]2(C)C(=S)CC[C@@H]12 |
| InChI | InChI=1S/C27H32OS/c1-3-19-15-23-20(16-25(19)28-17-18-7-5-4-6-8-18)9-10-22-21(23)13-14-27(2)24(22)11-12-26(27)29/h4-8,15-16,21-22,24H,3,9-14,17H2,1-2H3/t21-,22+,24-,27-/m0/s1 |
| InChIKey | RAQVQDSVRDDBQY-FVJFVQOASA-N |
| XLogP | 7.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|