C30H38O3 — CID 91125285
(8R,9S,13S,14S)-2-(4-hydroxypentyl)-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 91125285) has the molecular formula C30H38O3 and a molecular weight of 446.63 g/mol. Its IUPAC name is (8R,9S,13S,14S)-2-(4-hydroxypentyl)-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-2-(4-hydroxypentyl)-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 91125285 |
| Molecular Formula | C30H38O3 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | (8R,9S,13S,14S)-2-(4-hydroxypentyl)-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | CC(O)CCCc1cc2c(cc1OCc1ccccc1)CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C30H38O3/c1-20(31)7-6-10-23-17-26-22(18-28(23)33-19-21-8-4-3-5-9-21)11-12-25-24(26)15-16-30(2)27(25)13-14-29(30)32/h3-5,8-9,17-18,20,24-25,27,31H,6-7,10-16,19H2,1-2H3/t20?,24-,25+,27-,30-/m0/s1 |
| InChIKey | PEHPOHWEUAAQHI-DGHIVHMISA-N |
| XLogP | 6.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |