C28H39BrO3 — CID 54423622
(8R,9S,13S,14S)-2-(5-bromopentyl)-13-methyl-3-(oxan-2-yloxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 54423622) has the molecular formula C28H39BrO3 and a molecular weight of 503.52 g/mol. Its IUPAC name is (8R,9S,13S,14S)-2-(5-bromopentyl)-13-methyl-3-(oxan-2-yloxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-2-(5-bromopentyl)-13-methyl-3-(oxan-2-yloxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 54423622 |
| Molecular Formula | C28H39BrO3 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | (8R,9S,13S,14S)-2-(5-bromopentyl)-13-methyl-3-(oxan-2-yloxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H]3c4cc(CCCCCBr)c(OC5CCCCO5)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C28H39BrO3/c1-28-14-13-21-22(24(28)11-12-26(28)30)10-9-19-18-25(32-27-8-4-6-16-31-27)20(17-23(19)21)7-3-2-5-15-29/h17-18,21-22,24,27H,2-16H2,1H3/t21-,22+,24-,27?,28-/m0/s1 |
| InChIKey | WCNPXFZBCVMANT-LTYJFUNVSA-N |
| XLogP | 7.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|