C25H35NO5 — CID 168918226
(2-ethyl-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) N-(1,3-dihydroxy-2-methylpropan-2-yl)carbamate (PubChem CID 168918226) has the molecular formula C25H35NO5 and a molecular weight of 429.56 g/mol. Its IUPAC name is (2-ethyl-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) N-(1,3-dihydroxy-2-methylpropan-2-yl)carbamate.
| Compound Name | (2-ethyl-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) N-(1,3-dihydroxy-2-methylpropan-2-yl)carbamate |
|---|---|
| PubChem CID | 168918226 |
| Molecular Formula | C25H35NO5 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | (2-ethyl-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) N-(1,3-dihydroxy-2-methylpropan-2-yl)carbamate |
| SMILES | CCc1cc2c(cc1OC(=O)NC(C)(CO)CO)CCC1C2CCC2(C)C(=O)CCC12 |
| InChI | InChI=1S/C25H35NO5/c1-4-15-11-19-16(12-21(15)31-23(30)26-24(2,13-27)14-28)5-6-18-17(19)9-10-25(3)20(18)7-8-22(25)29/h11-12,17-18,20,27-28H,4-10,13-14H2,1-3H3,(H,26,30) |
| InChIKey | MAZYVFBLMWWEJQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |