C43H61B4FN2O4S — CID 168918152
CID 168918152 (PubChem CID 168918152) has the molecular formula C43H61B4FN2O4S and a molecular weight of 764.28 g/mol.
| Compound Name | CID 168918152 |
|---|---|
| PubChem CID | 168918152 |
| Molecular Formula | C43H61B4FN2O4S |
| Molecular Weight | 764.28 g/mol |
| Exact Mass | 764.47 |
| IUPAC Name | — |
| SMILES | CCC(C)(C)CC.CCc1cc2c(cc1OC(=O)Nc1ccc(N3CCOCC3)cc1)CCC1C2CCC2(C)C(=O)CCC12.[B]C([B])(F)C([B])([B])CCCS |
| InChI | InChI=1S/C31H38N2O4.C7H16.C5H7B4FS/c1-3-20-18-26-21(4-9-25-24(26)12-13-31(2)27(25)10-11-29(31)34)19-28(20)37-30(35)32-22-5-7-23(8-6-22)33-14-16-36-17-15-33;1-5-7(3,4)6-2;6-4(7,2-1-3-11)5(8,9)10/h5-8,18-19,24-25,27H,3-4,9-17H2,1-2H3,(H,32,35);5-6H2,1-4H3;11H,1-3H2 |
| InChIKey | FKQWEMHBNDQSFP-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.28 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|