About CID 168918152
CID 168918152 (PubChem CID 168918152) has the molecular formula C43H61B4FN2O4S
and a molecular weight of 764.28 g/mol.
Molecular Properties
| Compound Name | CID 168918152 |
| PubChem CID | 168918152 |
| Molecular Formula | C43H61B4FN2O4S |
| Molecular Weight | 764.28 g/mol |
| Exact Mass | 764.47 |
| IUPAC Name | — |
| SMILES | CCC(C)(C)CC.CCc1cc2c(cc1OC(=O)Nc1ccc(N3CCOCC3)cc1)CCC1C2CCC2(C)C(=O)CCC12.[B]C([B])(F)C([B])([B])CCCS |
| InChI | InChI=1S/C31H38N2O4.C7H16.C5H7B4FS/c1-3-20-18-26-21(4-9-25-24(26)12-13-31(2)27(25)10-11-29(31)34)19-28(20)37-30(35)32-22-5-7-23(8-6-22)33-14-16-36-17-15-33;1-5-7(3,4)6-2;6-4(7,2-1-3-11)5(8,9)10/h5-8,18-19,24-25,27H,3-4,9-17H2,1-2H3,(H,32,35);5-6H2,1-4H3;11H,1-3H2 |
| InChIKey | FKQWEMHBNDQSFP-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 764.28 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 168918152 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 168918152?
The IUPAC name of CID 168918152 (CID 168918152) is not available.
What is the SMILES notation for CID 168918152?
The canonical SMILES for CID 168918152 is CCC(C)(C)CC.CCc1cc2c(cc1OC(=O)Nc1ccc(N3CCOCC3)cc1)CCC1C2CCC2(C)C(=O)CCC12.[B]C([B])(F)C([B])([B])CCCS.
What is the InChIKey of CID 168918152?
The InChIKey is FKQWEMHBNDQSFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H38N2O4.C7H16.C5H7B4FS/c1-3-20-18-26-21(4-9-25-24(26)12-13-31(2)27(25)10-11-29(31)34)19-28(20)37-30(35)32-22-5-7-23(8-6-22)33-14-16-36-17-15-33;1-5-7(3,4)6-2;6-4(7,2-1-3-11)5(8,9)10/h5-8,18-19,24-25,27H,3-4,9-17H2,1-2H3,(H,32,35);5-6H2,1-4H3;11H,1-3H2.
What are the key properties of CID 168918152?
CID 168918152 has a molecular weight of 764.28 g/mol, XLogP of 9.06, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 168918152 is sourced from PubChem (CID 168918152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).