C24H33NO2 — CID 130416598
tert-butyl N-[(8S,9S,13S,14S)-13,17-dimethyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]carbamate (PubChem CID 130416598) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is tert-butyl N-[(8S,9S,13S,14S)-13,17-dimethyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]carbamate.
| Compound Name | tert-butyl N-[(8S,9S,13S,14S)-13,17-dimethyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]carbamate |
|---|---|
| PubChem CID | 130416598 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | tert-butyl N-[(8S,9S,13S,14S)-13,17-dimethyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]carbamate |
| SMILES | CC1=CC[C@H]2[C@@H]3CCc4cc(NC(=O)OC(C)(C)C)ccc4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C24H33NO2/c1-15-6-11-21-20-9-7-16-14-17(25-22(26)27-23(2,3)4)8-10-18(16)19(20)12-13-24(15,21)5/h6,8,10,14,19-21H,7,9,11-13H2,1-5H3,(H,25,26)/t19-,20-,21+,24-/m1/s1 |
| InChIKey | OXEXQXIUNUUJIJ-IUBSTNSRSA-N |
| XLogP | 6.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|