C18H28N2O3 — CID 103867686
tert-butyl N-[1-[(2-methylpropan-2-yl)oxyamino]-2,3-dihydro-1H-inden-5-yl]carbamate (PubChem CID 103867686) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is tert-butyl N-[1-[(2-methylpropan-2-yl)oxyamino]-2,3-dihydro-1H-inden-5-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(2-methylpropan-2-yl)oxyamino]-2,3-dihydro-1H-inden-5-yl]carbamate |
|---|---|
| PubChem CID | 103867686 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | tert-butyl N-[1-[(2-methylpropan-2-yl)oxyamino]-2,3-dihydro-1H-inden-5-yl]carbamate |
| SMILES | CC(C)(C)ONC1CCc2cc(NC(=O)OC(C)(C)C)ccc21 |
| InChI | InChI=1S/C18H28N2O3/c1-17(2,3)22-16(21)19-13-8-9-14-12(11-13)7-10-15(14)20-23-18(4,5)6/h8-9,11,15,20H,7,10H2,1-6H3,(H,19,21) |
| InChIKey | KHNCUZNHPXCRTE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|