C19H28N2O2 — CID 103522702
tert-butyl N-[1-(3-methylbut-2-enylamino)-2,3-dihydro-1H-inden-5-yl]carbamate (PubChem CID 103522702) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is tert-butyl N-[1-(3-methylbut-2-enylamino)-2,3-dihydro-1H-inden-5-yl]carbamate.
| Compound Name | tert-butyl N-[1-(3-methylbut-2-enylamino)-2,3-dihydro-1H-inden-5-yl]carbamate |
|---|---|
| PubChem CID | 103522702 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | tert-butyl N-[1-(3-methylbut-2-enylamino)-2,3-dihydro-1H-inden-5-yl]carbamate |
| SMILES | CC(C)=CCNC1CCc2cc(NC(=O)OC(C)(C)C)ccc21 |
| InChI | InChI=1S/C19H28N2O2/c1-13(2)10-11-20-17-9-6-14-12-15(7-8-16(14)17)21-18(22)23-19(3,4)5/h7-8,10,12,17,20H,6,9,11H2,1-5H3,(H,21,22) |
| InChIKey | JRTGIMMNZXSFDM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|