C26H39N2O5+ — CID 22870134
2-[2-[[(13S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]carbamoyloxy]acetyl]oxyethyl-trimethylazanium (PubChem CID 22870134) has the molecular formula C26H39N2O5+ and a molecular weight of 459.61 g/mol. Its IUPAC name is 2-[2-[[(13S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]carbamoyloxy]acetyl]oxyethyl-trimethylazanium.
| Compound Name | 2-[2-[[(13S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]carbamoyloxy]acetyl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 22870134 |
| Molecular Formula | C26H39N2O5+ |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | 2-[2-[[(13S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]carbamoyloxy]acetyl]oxyethyl-trimethylazanium |
| SMILES | C[C@]12CCC3c4ccc(NC(=O)OCC(=O)OCC[N+](C)(C)C)cc4CCC3C1CC[C@@H]2O |
| InChI | InChI=1S/C26H38N2O5/c1-26-12-11-20-19-8-6-18(15-17(19)5-7-21(20)22(26)9-10-23(26)29)27-25(31)33-16-24(30)32-14-13-28(2,3)4/h6,8,15,20-23,29H,5,7,9-14,16H2,1-4H3/p+1/t20?,21?,22?,23-,26-/m0/s1 |
| InChIKey | ZGVWGIMKVCYREC-LAPMQGOMSA-O |
| XLogP | 3.70 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|