C40H50O7 — CID 11158006
bis[(13S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 2-hydroxybutanedioate (PubChem CID 11158006) has the molecular formula C40H50O7 and a molecular weight of 642.83 g/mol. Its IUPAC name is bis[(13S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 2-hydroxybutanedioate.
| Compound Name | bis[(13S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 2-hydroxybutanedioate |
|---|---|
| PubChem CID | 11158006 |
| Molecular Formula | C40H50O7 |
| Molecular Weight | 642.83 g/mol |
| Exact Mass | 642.36 |
| IUPAC Name | bis[(13S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 2-hydroxybutanedioate |
| SMILES | C[C@]12CCC3c4ccc(OC(=O)CC(O)C(=O)Oc5ccc6c(c5)CCC5C6CC[C@@]6(C)C5CC[C@@H]6O)cc4CCC3C1CC[C@@H]2O |
| InChI | InChI=1S/C40H50O7/c1-39-17-15-28-26-9-5-24(19-22(26)3-7-30(28)32(39)11-13-35(39)42)46-37(44)21-34(41)38(45)47-25-6-10-27-23(20-25)4-8-31-29(27)16-18-40(2)33(31)12-14-36(40)43/h5-6,9-10,19-20,28-36,41-43H,3-4,7-8,11-18,21H2,1-2H3/t28?,29?,30?,31?,32?,33?,34?,35-,36-,39-,40-/m0/s1 |
| InChIKey | VMPHMVBFMYARKP-MJINQMGPSA-N |
| XLogP | 6.38 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.83 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|