C24H36N2O3 — CID 156742669
(17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) N-[2-(dimethylamino)ethyl]-N-methylcarbamate (PubChem CID 156742669) has the molecular formula C24H36N2O3 and a molecular weight of 400.56 g/mol. Its IUPAC name is (17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) N-[2-(dimethylamino)ethyl]-N-methylcarbamate.
| Compound Name | (17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) N-[2-(dimethylamino)ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 156742669 |
| Molecular Formula | C24H36N2O3 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | (17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) N-[2-(dimethylamino)ethyl]-N-methylcarbamate |
| SMILES | CN(C)CCN(C)C(=O)Oc1ccc2c(c1)CCC1C2CCC2(C)C(O)CCC12 |
| InChI | InChI=1S/C24H36N2O3/c1-24-12-11-19-18-8-6-17(29-23(28)26(4)14-13-25(2)3)15-16(18)5-7-20(19)21(24)9-10-22(24)27/h6,8,15,19-22,27H,5,7,9-14H2,1-4H3 |
| InChIKey | AYDNJCUTHDLZQA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |