C27H42N2O3 — CID 153367199
ethane;(17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) 2-(4-methylpiperazin-1-yl)acetate (PubChem CID 153367199) has the molecular formula C27H42N2O3 and a molecular weight of 442.64 g/mol. Its IUPAC name is ethane;(17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) 2-(4-methylpiperazin-1-yl)acetate.
| Compound Name | ethane;(17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) 2-(4-methylpiperazin-1-yl)acetate |
|---|---|
| PubChem CID | 153367199 |
| Molecular Formula | C27H42N2O3 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.32 |
| IUPAC Name | ethane;(17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) 2-(4-methylpiperazin-1-yl)acetate |
| SMILES | CC.CN1CCN(CC(=O)Oc2ccc3c(c2)CCC2C3CCC3(C)C(O)CCC23)CC1 |
| InChI | InChI=1S/C25H36N2O3.C2H6/c1-25-10-9-20-19-6-4-18(30-24(29)16-27-13-11-26(2)12-14-27)15-17(19)3-5-21(20)22(25)7-8-23(25)28;1-2/h4,6,15,20-23,28H,3,5,7-14,16H2,1-2H3;1-2H3 |
| InChIKey | AHNZITCXQCZGQV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|