C25H25I3O3 — CID 21014851
(17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) 3,4,5-triiodobenzoate (PubChem CID 21014851) has the molecular formula C25H25I3O3 and a molecular weight of 754.18 g/mol. Its IUPAC name is (17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) 3,4,5-triiodobenzoate.
| Compound Name | (17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) 3,4,5-triiodobenzoate |
|---|---|
| PubChem CID | 21014851 |
| Molecular Formula | C25H25I3O3 |
| Molecular Weight | 754.18 g/mol |
| Exact Mass | 753.89 |
| IUPAC Name | (17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) 3,4,5-triiodobenzoate |
| SMILES | CC12CCC3c4ccc(OC(=O)c5cc(I)c(I)c(I)c5)cc4CCC3C1CCC2O |
| InChI | InChI=1S/C25H25I3O3/c1-25-9-8-17-16-5-3-15(31-24(30)14-11-20(26)23(28)21(27)12-14)10-13(16)2-4-18(17)19(25)6-7-22(25)29/h3,5,10-12,17-19,22,29H,2,4,6-9H2,1H3 |
| InChIKey | DIMWNGPXJDROPM-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.18 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|