C26H36N2O5 — CID 58795694
[(13S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 2-[[3-(methylamino)-4-oxopentanoyl]amino]acetate (PubChem CID 58795694) has the molecular formula C26H36N2O5 and a molecular weight of 456.58 g/mol. Its IUPAC name is [(13S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 2-[[3-(methylamino)-4-oxopentanoyl]amino]acetate.
| Compound Name | [(13S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 2-[[3-(methylamino)-4-oxopentanoyl]amino]acetate |
|---|---|
| PubChem CID | 58795694 |
| Molecular Formula | C26H36N2O5 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | [(13S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 2-[[3-(methylamino)-4-oxopentanoyl]amino]acetate |
| SMILES | CNC(CC(=O)NCC(=O)Oc1ccc2c(c1)CCC1C2CC[C@@]2(C)C1CC[C@@H]2O)C(C)=O |
| InChI | InChI=1S/C26H36N2O5/c1-15(29)22(27-3)13-24(31)28-14-25(32)33-17-5-7-18-16(12-17)4-6-20-19(18)10-11-26(2)21(20)8-9-23(26)30/h5,7,12,19-23,27,30H,4,6,8-11,13-14H2,1-3H3,(H,28,31)/t19?,20?,21?,22?,23-,26-/m0/s1 |
| InChIKey | SWZUJCDZDZLHGM-KSACEDFZSA-N |
| XLogP | 2.49 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|