C23H38NO6P — CID 172768758
(8R,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol;2-(trimethylazaniumyl)ethyl hydrogen phosphate (PubChem CID 172768758) has the molecular formula C23H38NO6P and a molecular weight of 455.53 g/mol. Its IUPAC name is (8R,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol;2-(trimethylazaniumyl)ethyl hydrogen phosphate.
| Compound Name | (8R,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol;2-(trimethylazaniumyl)ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 172768758 |
| Molecular Formula | C23H38NO6P |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | (8R,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol;2-(trimethylazaniumyl)ethyl hydrogen phosphate |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CCC2O.C[N+](C)(C)CCOP(=O)([O-])O |
| InChI | InChI=1S/C18H24O2.C5H14NO4P/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20;1-6(2,3)4-5-10-11(7,8)9/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3;4-5H2,1-3H3,(H-,7,8,9)/t14-,15-,16+,17?,18+;/m1./s1 |
| InChIKey | MQZMFAWZQUAJPK-WAJSLEGFSA-N |
| XLogP | 2.78 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|