C21H29N3O11 — CID 87486313
1,3-dinitrooxypropan-2-yl nitrate;(8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 87486313) has the molecular formula C21H29N3O11 and a molecular weight of 499.47 g/mol. Its IUPAC name is 1,3-dinitrooxypropan-2-yl nitrate;(8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | 1,3-dinitrooxypropan-2-yl nitrate;(8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 87486313 |
| Molecular Formula | C21H29N3O11 |
| Molecular Weight | 499.47 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 1,3-dinitrooxypropan-2-yl nitrate;(8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@H]2O.O=[N+]([O-])OCC(CO[N+](=O)[O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C18H24O2.C3H5N3O9/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20;7-4(8)13-1-3(15-6(11)12)2-14-5(9)10/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3;3H,1-2H2/t14-,15-,16+,17+,18+;/m1./s1 |
| InChIKey | DSRKVEAAYLZIOP-CMZLOHJFSA-N |
| XLogP | 2.59 |
| TPSA | 197.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|