C29H45N2O5+ — CID 67700395
triethyl-[2-[2-[[(13S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]carbamoyloxy]acetyl]oxyethyl]azanium (PubChem CID 67700395) has the molecular formula C29H45N2O5+ and a molecular weight of 501.69 g/mol. Its IUPAC name is triethyl-[2-[2-[[(13S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]carbamoyloxy]acetyl]oxyethyl]azanium.
| Compound Name | triethyl-[2-[2-[[(13S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]carbamoyloxy]acetyl]oxyethyl]azanium |
|---|---|
| PubChem CID | 67700395 |
| Molecular Formula | C29H45N2O5+ |
| Molecular Weight | 501.69 g/mol |
| Exact Mass | 501.33 |
| IUPAC Name | triethyl-[2-[2-[[(13S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]carbamoyloxy]acetyl]oxyethyl]azanium |
| SMILES | CC[N+](CC)(CC)CCOC(=O)COC(=O)N[C@H]1CCC2C3CCc4cc(O)ccc4C3CC[C@@]21C |
| InChI | InChI=1S/C29H44N2O5/c1-5-31(6-2,7-3)16-17-35-27(33)19-36-28(34)30-26-13-12-25-24-10-8-20-18-21(32)9-11-22(20)23(24)14-15-29(25,26)4/h9,11,18,23-26H,5-8,10,12-17,19H2,1-4H3,(H-,30,32,34)/p+1/t23?,24?,25?,26-,29-/m0/s1 |
| InChIKey | BOXDOKZGVSYROZ-LDFSQWPGSA-O |
| XLogP | 4.76 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.69 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|