C29H36N2O4 — CID 102351403
benzyl N-[(2S)-1-[[(8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 102351403) has the molecular formula C29H36N2O4 and a molecular weight of 476.62 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 102351403 |
| Molecular Formula | C29H36N2O4 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | benzyl N-[(2S)-1-[[(8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@H]1CC[C@H]2[C@@H]3CCc4cc(O)ccc4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H36N2O4/c1-18(30-28(34)35-17-19-6-4-3-5-7-19)27(33)31-26-13-12-25-24-10-8-20-16-21(32)9-11-22(20)23(24)14-15-29(25,26)2/h3-7,9,11,16,18,23-26,32H,8,10,12-15,17H2,1-2H3,(H,30,34)(H,31,33)/t18-,23+,24+,25-,26-,29-/m0/s1 |
| InChIKey | VUSKVVQUFCEYLS-MDABYZBOSA-N |
| XLogP | 5.05 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |