C35H37NO5 — CID 102253356
[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 102253356) has the molecular formula C35H37NO5 and a molecular weight of 551.68 g/mol. Its IUPAC name is [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 102253356 |
| Molecular Formula | C35H37NO5 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OC(=O)[C@H](Cc5ccccc5)NC(=O)OCc5ccccc5)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C35H37NO5/c1-35-19-18-28-27-15-13-26(21-25(27)12-14-29(28)30(35)16-17-32(35)37)41-33(38)31(20-23-8-4-2-5-9-23)36-34(39)40-22-24-10-6-3-7-11-24/h2-11,13,15,21,28-31H,12,14,16-20,22H2,1H3,(H,36,39)/t28-,29-,30+,31+,35+/m1/s1 |
| InChIKey | YCAMTRRXVGJANX-PGZPJYDJSA-N |
| XLogP | 6.55 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|